C29H42N3O12P — CID 168749736
[(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[[6-(hex-1-ynylcarbamoylamino)-3-pyridinyl]oxy]oxan-3-yl] acetate (PubChem CID 168749736) has the molecular formula C29H42N3O12P and a molecular weight of 655.64 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[[6-(hex-1-ynylcarbamoylamino)-3-pyridinyl]oxy]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[[6-(hex-1-ynylcarbamoylamino)-3-pyridinyl]oxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 168749736 |
| Molecular Formula | C29H42N3O12P |
| Molecular Weight | 655.64 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[[6-(hex-1-ynylcarbamoylamino)-3-pyridinyl]oxy]oxan-3-yl] acetate |
| SMILES | CCCCC#CNC(=O)Nc1ccc(O[C@H]2O[C@H](CCP(=O)(OCC)OCC)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)cn1 |
| InChI | InChI=1S/C29H42N3O12P/c1-7-10-11-12-16-30-29(36)32-24-14-13-22(18-31-24)43-28-27(42-21(6)35)26(41-20(5)34)25(40-19(4)33)23(44-28)15-17-45(37,38-8-2)39-9-3/h13-14,18,23,25-28H,7-11,15,17H2,1-6H3,(H2,30,31,32,36)/t23-,25-,26+,27+,28+/m1/s1 |
| InChIKey | MPYXDCSFDYKTFX-NWWWPDLMSA-N |
| XLogP | 3.91 |
| TPSA | 186.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.64 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|