C17H29O11P — CID 142587032
[(2R,3R,4R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethoxymethyl)oxolan-3-yl] acetate (PubChem CID 142587032) has the molecular formula C17H29O11P and a molecular weight of 440.38 g/mol. Its IUPAC name is [(2R,3R,4R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethoxymethyl)oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethoxymethyl)oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 142587032 |
| Molecular Formula | C17H29O11P |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [(2R,3R,4R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethoxymethyl)oxolan-3-yl] acetate |
| SMILES | CCOP(=O)(CCOC[C@H]1OC(OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C17H29O11P/c1-6-23-29(21,24-7-2)9-8-22-10-14-15(25-11(3)18)16(26-12(4)19)17(28-14)27-13(5)20/h14-17H,6-10H2,1-5H3/t14-,15-,16-,17?/m1/s1 |
| InChIKey | AFMNZJKMLXRCFM-HJNZIYBASA-N |
| XLogP | 1.42 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|