C27H37N2O12P — CID 166068896
2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(hex-5-ynylcarbamoylamino)-2-methylphenoxy]oxan-2-yl]ethylphosphonic acid (PubChem CID 166068896) has the molecular formula C27H37N2O12P and a molecular weight of 612.57 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(hex-5-ynylcarbamoylamino)-2-methylphenoxy]oxan-2-yl]ethylphosphonic acid.
| Compound Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(hex-5-ynylcarbamoylamino)-2-methylphenoxy]oxan-2-yl]ethylphosphonic acid |
|---|---|
| PubChem CID | 166068896 |
| Molecular Formula | C27H37N2O12P |
| Molecular Weight | 612.57 g/mol |
| Exact Mass | 612.21 |
| IUPAC Name | 2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyloxy-6-[4-(hex-5-ynylcarbamoylamino)-2-methylphenoxy]oxan-2-yl]ethylphosphonic acid |
| SMILES | C#CCCCCNC(=O)Nc1ccc(O[C@H]2O[C@H](CCP(=O)(O)O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]2OC(C)=O)c(C)c1 |
| InChI | InChI=1S/C27H37N2O12P/c1-6-7-8-9-13-28-27(33)29-20-10-11-21(16(2)15-20)40-26-25(39-19(5)32)24(38-18(4)31)23(37-17(3)30)22(41-26)12-14-42(34,35)36/h1,10-11,15,22-26H,7-9,12-14H2,2-5H3,(H2,28,29,33)(H2,34,35,36)/t22-,23-,24+,25+,26+/m1/s1 |
| InChIKey | WMJHRHDZIGFJOB-JMTTVTNBSA-N |
| XLogP | 2.39 |
| TPSA | 196.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|