C25H34NO15P — CID 166172058
[(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(2-acetyloxy-4-nitrophenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate (PubChem CID 166172058) has the molecular formula C25H34NO15P and a molecular weight of 619.51 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(2-acetyloxy-4-nitrophenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(2-acetyloxy-4-nitrophenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate |
|---|---|
| PubChem CID | 166172058 |
| Molecular Formula | C25H34NO15P |
| Molecular Weight | 619.51 g/mol |
| Exact Mass | 619.17 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-6-(2-acetyloxy-4-nitrophenoxy)-2-(2-diethoxyphosphorylethyl)oxan-3-yl] acetate |
| SMILES | CCOP(=O)(CC[C@H]1O[C@H](Oc2ccc([N+](=O)[O-])cc2OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C25H34NO15P/c1-7-34-42(33,35-8-2)12-11-20-22(37-15(4)28)23(38-16(5)29)24(39-17(6)30)25(41-20)40-19-10-9-18(26(31)32)13-21(19)36-14(3)27/h9-10,13,20,22-25H,7-8,11-12H2,1-6H3/t20-,22-,23+,24+,25+/m1/s1 |
| InChIKey | YNAYLSPLFOYKMY-PLFWLVBQSA-N |
| XLogP | 3.08 |
| TPSA | 202.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|