C28H41O11PSi — CID 166172071
[(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[4-(2-trimethylsilylethynyl)phenoxy]oxan-3-yl] acetate (PubChem CID 166172071) has the molecular formula C28H41O11PSi and a molecular weight of 612.69 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[4-(2-trimethylsilylethynyl)phenoxy]oxan-3-yl] acetate.
| Compound Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[4-(2-trimethylsilylethynyl)phenoxy]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 166172071 |
| Molecular Formula | C28H41O11PSi |
| Molecular Weight | 612.69 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | [(2R,3R,4S,5S,6R)-4,5-diacetyloxy-2-(2-diethoxyphosphorylethyl)-6-[4-(2-trimethylsilylethynyl)phenoxy]oxan-3-yl] acetate |
| SMILES | CCOP(=O)(CC[C@H]1O[C@H](Oc2ccc(C#C[Si](C)(C)C)cc2)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O)OCC |
| InChI | InChI=1S/C28H41O11PSi/c1-9-33-40(32,34-10-2)17-15-24-25(35-19(3)29)26(36-20(4)30)27(37-21(5)31)28(39-24)38-23-13-11-22(12-14-23)16-18-41(6,7)8/h11-14,24-28H,9-10,15,17H2,1-8H3/t24-,25-,26+,27+,28+/m1/s1 |
| InChIKey | CNFUAYASTHJZTK-MASCHLQQSA-N |
| XLogP | 4.47 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.69 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|