C17H24O11 — CID 134482395
2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-acetyloxyethyl)oxan-2-yl]acetic acid (PubChem CID 134482395) has the molecular formula C17H24O11 and a molecular weight of 404.37 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-acetyloxyethyl)oxan-2-yl]acetic acid.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-acetyloxyethyl)oxan-2-yl]acetic acid |
|---|---|
| PubChem CID | 134482395 |
| Molecular Formula | C17H24O11 |
| Molecular Weight | 404.37 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(2-acetyloxyethyl)oxan-2-yl]acetic acid |
| SMILES | CC(=O)OCC[C@H]1O[C@H](CC(=O)O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C17H24O11/c1-8(18)24-6-5-12-15(25-9(2)19)17(27-11(4)21)16(26-10(3)20)13(28-12)7-14(22)23/h12-13,15-17H,5-7H2,1-4H3,(H,22,23)/t12-,13-,15-,16-,17+/m1/s1 |
| InChIKey | UEESBXCBHNIPQT-HSMRXVHUSA-N |
| XLogP | -0.02 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.37 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|