C21H34O10 — CID 71106674
[3,4,5-triacetyloxy-6-(6-methoxyhexyl)oxan-2-yl]methyl acetate (PubChem CID 71106674) has the molecular formula C21H34O10 and a molecular weight of 446.49 g/mol. Its IUPAC name is [3,4,5-triacetyloxy-6-(6-methoxyhexyl)oxan-2-yl]methyl acetate.
| Compound Name | [3,4,5-triacetyloxy-6-(6-methoxyhexyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 71106674 |
| Molecular Formula | C21H34O10 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | [3,4,5-triacetyloxy-6-(6-methoxyhexyl)oxan-2-yl]methyl acetate |
| SMILES | COCCCCCCC1OC(COC(C)=O)C(OC(C)=O)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H34O10/c1-13(22)27-12-18-20(29-15(3)24)21(30-16(4)25)19(28-14(2)23)17(31-18)10-8-6-7-9-11-26-5/h17-21H,6-12H2,1-5H3 |
| InChIKey | AYJTXPVWCMYTKN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|