C18H26O10 — CID 10993101
[(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-oxobutyl)oxan-2-yl]methyl acetate (PubChem CID 10993101) has the molecular formula C18H26O10 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-oxobutyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-oxobutyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10993101 |
| Molecular Formula | C18H26O10 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-(3-oxobutyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)CC[C@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H26O10/c1-9(19)6-7-14-16(25-11(3)21)18(27-13(5)23)17(26-12(4)22)15(28-14)8-24-10(2)20/h14-18H,6-8H2,1-5H3/t14-,15-,16+,17-,18-/m1/s1 |
| InChIKey | DAYIHQUXPHZSJD-UYTYNIKBSA-N |
| XLogP | 0.48 |
| TPSA | 131.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|