C18H26O9 — CID 59237831
[(3S,4R,6S)-3,4,5-triacetyloxy-6-but-3-enyloxan-2-yl]methyl acetate (PubChem CID 59237831) has the molecular formula C18H26O9 and a molecular weight of 386.40 g/mol. Its IUPAC name is [(3S,4R,6S)-3,4,5-triacetyloxy-6-but-3-enyloxan-2-yl]methyl acetate.
| Compound Name | [(3S,4R,6S)-3,4,5-triacetyloxy-6-but-3-enyloxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 59237831 |
| Molecular Formula | C18H26O9 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | [(3S,4R,6S)-3,4,5-triacetyloxy-6-but-3-enyloxan-2-yl]methyl acetate |
| SMILES | C=CCC[C@@H]1OC(COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C18H26O9/c1-6-7-8-14-16(24-11(3)20)18(26-13(5)22)17(25-12(4)21)15(27-14)9-23-10(2)19/h6,14-18H,1,7-9H2,2-5H3/t14-,15?,16?,17-,18+/m0/s1 |
| InChIKey | BRNLBQJFECXYQU-VLMYXLFRSA-N |
| XLogP | 1.08 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|