C20H31NO11 — CID 101341480
[(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-hydroxypropylamino)-3-oxopropyl]oxan-2-yl]methyl acetate (PubChem CID 101341480) has the molecular formula C20H31NO11 and a molecular weight of 461.46 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-hydroxypropylamino)-3-oxopropyl]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-hydroxypropylamino)-3-oxopropyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 101341480 |
| Molecular Formula | C20H31NO11 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [(2R,3R,4R,5S,6R)-3,4,5-triacetyloxy-6-[3-(3-hydroxypropylamino)-3-oxopropyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](CCC(=O)NCCCO)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C20H31NO11/c1-11(23)28-10-16-19(30-13(3)25)20(31-14(4)26)18(29-12(2)24)15(32-16)6-7-17(27)21-8-5-9-22/h15-16,18-20,22H,5-10H2,1-4H3,(H,21,27)/t15-,16-,18+,19-,20-/m1/s1 |
| InChIKey | ULTZNECCMYBFEZ-SCQOQHIRSA-N |
| XLogP | -0.61 |
| TPSA | 163.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|