C16H24O9 — CID 10498714
[(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(2-hydroxyethyl)-6-(2-oxoethyl)oxan-2-yl]methyl acetate (PubChem CID 10498714) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(2-hydroxyethyl)-6-(2-oxoethyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(2-hydroxyethyl)-6-(2-oxoethyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10498714 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(2R,3S,4R,5S,6R)-3,4-diacetyloxy-5-(2-hydroxyethyl)-6-(2-oxoethyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@H](CC=O)[C@H](CCO)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O9/c1-9(19)22-8-14-16(24-11(3)21)15(23-10(2)20)12(4-6-17)13(25-14)5-7-18/h7,12-17H,4-6,8H2,1-3H3/t12-,13+,14+,15+,16+/m0/s1 |
| InChIKey | HPBOXCDUOZRTGD-UYJHQMFVSA-N |
| XLogP | -0.23 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|