C27H40NO16P — CID 126706959
2-[2-[(2S,3R,5S)-3-[(2R,3R,5S)-6-(2-diethoxyphosphorylethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]isoindole-1,3-dione (PubChem CID 126706959) has the molecular formula C27H40NO16P and a molecular weight of 665.58 g/mol. Its IUPAC name is 2-[2-[(2S,3R,5S)-3-[(2R,3R,5S)-6-(2-diethoxyphosphorylethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]isoindole-1,3-dione.
| Compound Name | 2-[2-[(2S,3R,5S)-3-[(2R,3R,5S)-6-(2-diethoxyphosphorylethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 126706959 |
| Molecular Formula | C27H40NO16P |
| Molecular Weight | 665.58 g/mol |
| Exact Mass | 665.21 |
| IUPAC Name | 2-[2-[(2S,3R,5S)-3-[(2R,3R,5S)-6-(2-diethoxyphosphorylethyl)-3,4,5-trihydroxyoxan-2-yl]oxy-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyethoxy]isoindole-1,3-dione |
| SMILES | CCOP(=O)(CCC1O[C@H](O[C@@H]2C(O)[C@H](O)C(CO)O[C@@H]2OCCON2C(=O)c3ccccc3C2=O)[C@H](O)C(O)[C@@H]1O)OCC |
| InChI | InChI=1S/C27H40NO16P/c1-3-40-45(37,41-4-2)12-9-16-18(30)20(32)22(34)26(42-16)44-23-21(33)19(31)17(13-29)43-27(23)38-10-11-39-28-24(35)14-7-5-6-8-15(14)25(28)36/h5-8,16-23,26-27,29-34H,3-4,9-13H2,1-2H3/t16?,17?,18-,19-,20?,21?,22-,23-,26-,27+/m1/s1 |
| InChIKey | XLRYZXXPTBMLDZ-QJPQBOBWSA-N |
| XLogP | -1.48 |
| TPSA | 240.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.58 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|