C14H22O7 — CID 174963793
(2R,3R,4S,5R,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol;phenol (PubChem CID 174963793) has the molecular formula C14H22O7 and a molecular weight of 302.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol;phenol.
| Compound Name | (2R,3R,4S,5R,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol;phenol |
|---|---|
| PubChem CID | 174963793 |
| Molecular Formula | C14H22O7 |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol;phenol |
| SMILES | CCO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O.Oc1ccccc1 |
| InChI | InChI=1S/C8H16O6.C6H6O/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8;7-6-4-2-1-3-5-6/h4-12H,2-3H2,1H3;1-5,7H/t4-,5+,6+,7-,8-;/m1./s1 |
| InChIKey | BCMMOBYEBPNHJL-AGOZRGOYSA-N |
| XLogP | -0.79 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |