C8H16Ac4O6 — CID 59059867
actinium;(2S,4S,5S)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 59059867) has the molecular formula C8H16Ac4O6 and a molecular weight of 1116.21 g/mol. Its IUPAC name is actinium;(2S,4S,5S)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | actinium;(2S,4S,5S)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59059867 |
| Molecular Formula | C8H16Ac4O6 |
| Molecular Weight | 1116.21 g/mol |
| Exact Mass | 1116.21 |
| IUPAC Name | actinium;(2S,4S,5S)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCO[C@H]1OC(CO)[C@@H](O)[C@H](O)C1O.[Ac].[Ac].[Ac].[Ac] |
| InChI | InChI=1S/C8H16O6.4Ac/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8;;;;/h4-12H,2-3H2,1H3;;;;/t4?,5-,6+,7?,8+;;;;/m1..../s1 |
| InChIKey | ACHANXJDDYOOIV-ZKVPWKASSA-N |
| XLogP | -2.18 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 1116.21 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |