C8H16O6 — CID 121419897
(2R,5R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 121419897) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is (2R,5R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,5R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 121419897 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | (2R,5R)-2-ethoxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCO[C@@H]1OC(CO)[C@H](O)C(O)C1O |
| InChI | InChI=1S/C8H16O6/c1-2-13-8-7(12)6(11)5(10)4(3-9)14-8/h4-12H,2-3H2,1H3/t4?,5-,6?,7?,8+/m0/s1 |
| InChIKey | WYUFTYLVLQZQNH-JIAKPCSOSA-N |
| XLogP | -2.18 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |