C16H20N2O7 — CID 142450334
2-[2-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 142450334) has the molecular formula C16H20N2O7 and a molecular weight of 352.34 g/mol. Its IUPAC name is 2-[2-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142450334 |
| Molecular Formula | C16H20N2O7 |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 2-[2-(2-aminoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | NCCOC1OC(CO)C(O)C(O)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H20N2O7/c17-5-6-24-16-11(13(21)12(20)10(7-19)25-16)18-14(22)8-3-1-2-4-9(8)15(18)23/h1-4,10-13,16,19-21H,5-7,17H2 |
| InChIKey | RFFKLKBROOABJB-UHFFFAOYSA-N |
| XLogP | -1.93 |
| TPSA | 142.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | -1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|