C24H32N4O5 — CID 146620607
6-(6-aminohexoxy)-2-(hydroxymethyl)-5-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4-diol (PubChem CID 146620607) has the molecular formula C24H32N4O5 and a molecular weight of 456.54 g/mol. Its IUPAC name is 6-(6-aminohexoxy)-2-(hydroxymethyl)-5-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4-diol.
| Compound Name | 6-(6-aminohexoxy)-2-(hydroxymethyl)-5-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4-diol |
|---|---|
| PubChem CID | 146620607 |
| Molecular Formula | C24H32N4O5 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.24 |
| IUPAC Name | 6-(6-aminohexoxy)-2-(hydroxymethyl)-5-(4-naphthalen-1-yltriazol-1-yl)oxane-3,4-diol |
| SMILES | NCCCCCCOC1OC(CO)C(O)C(O)C1n1cc(-c2cccc3ccccc23)nn1 |
| InChI | InChI=1S/C24H32N4O5/c25-12-5-1-2-6-13-32-24-21(23(31)22(30)20(15-29)33-24)28-14-19(26-27-28)18-11-7-9-16-8-3-4-10-17(16)18/h3-4,7-11,14,20-24,29-31H,1-2,5-6,12-13,15,25H2 |
| InChIKey | RYNGRHYMQXIKMI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 135.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|