C15H18N2O6 — CID 138634619
2-[(3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 138634619) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is 2-[(3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 138634619 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-[(3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | COC1O[C@H](CN)[C@@H](O)[C@H](O)[C@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18N2O6/c1-22-15-10(12(19)11(18)9(6-16)23-15)17-13(20)7-4-2-3-5-8(7)14(17)21/h2-5,9-12,15,18-19H,6,16H2,1H3/t9-,10-,11-,12-,15?/m1/s1 |
| InChIKey | TXNXQAKEASOINL-XPWNBWMWSA-N |
| XLogP | -1.30 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|