C20H25NO7 — CID 101446803
1-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl]-3,4-dimethylpyrrole-2,5-dione (PubChem CID 101446803) has the molecular formula C20H25NO7 and a molecular weight of 391.42 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl]-3,4-dimethylpyrrole-2,5-dione.
| Compound Name | 1-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl]-3,4-dimethylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 101446803 |
| Molecular Formula | C20H25NO7 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1-[(2S,3R,4R,5S,6R)-4,5-dihydroxy-2-methoxy-6-(phenylmethoxymethyl)oxan-3-yl]-3,4-dimethylpyrrole-2,5-dione |
| SMILES | CO[C@H]1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](O)[C@H]1N1C(=O)C(C)=C(C)C1=O |
| InChI | InChI=1S/C20H25NO7/c1-11-12(2)19(25)21(18(11)24)15-17(23)16(22)14(28-20(15)26-3)10-27-9-13-7-5-4-6-8-13/h4-8,14-17,20,22-23H,9-10H2,1-3H3/t14-,15-,16-,17-,20+/m1/s1 |
| InChIKey | LVHPIONMQRUHJX-RXFYRGCNSA-N |
| XLogP | 0.37 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|