C23H23NO7 — CID 67519057
[(4R,5S)-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-methoxy-4-methyloxan-2-yl]methyl benzoate (PubChem CID 67519057) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is [(4R,5S)-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-methoxy-4-methyloxan-2-yl]methyl benzoate.
| Compound Name | [(4R,5S)-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-methoxy-4-methyloxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 67519057 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | [(4R,5S)-5-(1,3-dioxoisoindol-2-yl)-3-hydroxy-6-methoxy-4-methyloxan-2-yl]methyl benzoate |
| SMILES | COC1OC(COC(=O)c2ccccc2)C(O)[C@H](C)[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H23NO7/c1-13-18(24-20(26)15-10-6-7-11-16(15)21(24)27)23(29-2)31-17(19(13)25)12-30-22(28)14-8-4-3-5-9-14/h3-11,13,17-19,23,25H,12H2,1-2H3/t13-,17?,18+,19?,23?/m1/s1 |
| InChIKey | QQJBTNDQTSTWJF-BQGRFPQCSA-N |
| XLogP | 1.88 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|