C16H19NO6 — CID 161128246
2-[(3S,4R,5S)-6-ethyl-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione (PubChem CID 161128246) has the molecular formula C16H19NO6 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[(3S,4R,5S)-6-ethyl-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,4R,5S)-6-ethyl-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 161128246 |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2-[(3S,4R,5S)-6-ethyl-4,5-dihydroxy-2-methoxyoxan-3-yl]isoindole-1,3-dione |
| SMILES | CCC1OC(OC)[C@@H](N2C(=O)c3ccccc3C2=O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H19NO6/c1-3-10-12(18)13(19)11(16(22-2)23-10)17-14(20)8-6-4-5-7-9(8)15(17)21/h4-7,10-13,16,18-19H,3H2,1-2H3/t10?,11-,12+,13+,16?/m0/s1 |
| InChIKey | YRTWIHCMUWZKGT-MDHSGYCPSA-N |
| XLogP | 0.15 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|