C16H18N4O7 — CID 140589424
2-[(2R,4R,5R)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione (PubChem CID 140589424) has the molecular formula C16H18N4O7 and a molecular weight of 378.34 g/mol. Its IUPAC name is 2-[(2R,4R,5R)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2R,4R,5R)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 140589424 |
| Molecular Formula | C16H18N4O7 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-[(2R,4R,5R)-2-(2-azidoethoxy)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCCO[C@@H]1OC(CO)[C@H](O)[C@H](O)C1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C16H18N4O7/c17-19-18-5-6-26-16-11(13(23)12(22)10(7-21)27-16)20-14(24)8-3-1-2-4-9(8)15(20)25/h1-4,10-13,16,21-23H,5-7H2/t10?,11?,12-,13+,16+/m0/s1 |
| InChIKey | SAYZGXAHUVLPSQ-CXRJLBHSSA-N |
| XLogP | -0.58 |
| TPSA | 165.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|