C21H26N4O5 — CID 101359997
(2R,3S,4R,5R,6R)-6-(2-azidoethoxy)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methylamino]oxane-3,4-diol (PubChem CID 101359997) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2R,3S,4R,5R,6R)-6-(2-azidoethoxy)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methylamino]oxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R,6R)-6-(2-azidoethoxy)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methylamino]oxane-3,4-diol |
|---|---|
| PubChem CID | 101359997 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (2R,3S,4R,5R,6R)-6-(2-azidoethoxy)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methylamino]oxane-3,4-diol |
| SMILES | [N-]=[N+]=NCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C21H26N4O5/c22-25-24-10-11-29-21-18(20(28)19(27)17(13-26)30-21)23-12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,17-21,23,26-28H,10-13H2/t17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | SPKOVMASVZNQRN-PFAUGDHASA-N |
| XLogP | 1.58 |
| TPSA | 139.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|