C22H27NO5 — CID 67974628
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-[(3-phenylphenyl)methylamino]-6-prop-2-enoxyoxane-3,4-diol (PubChem CID 67974628) has the molecular formula C22H27NO5 and a molecular weight of 385.46 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[(3-phenylphenyl)methylamino]-6-prop-2-enoxyoxane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[(3-phenylphenyl)methylamino]-6-prop-2-enoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 67974628 |
| Molecular Formula | C22H27NO5 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-[(3-phenylphenyl)methylamino]-6-prop-2-enoxyoxane-3,4-diol |
| SMILES | C=CCOC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1NCc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H27NO5/c1-2-11-27-22-19(21(26)20(25)18(14-24)28-22)23-13-15-7-6-10-17(12-15)16-8-4-3-5-9-16/h2-10,12,18-26H,1,11,13-14H2/t18-,19-,20-,21-,22?/m1/s1 |
| InChIKey | HSLSACFZFZSVNM-HDKZTWHISA-N |
| XLogP | 1.45 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|