C16H20O6 — CID 89090282
[(2S,3S,4S,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl]-phenylmethanone (PubChem CID 89090282) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is [(2S,3S,4S,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl]-phenylmethanone.
| Compound Name | [(2S,3S,4S,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 89090282 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [(2S,3S,4S,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl]-phenylmethanone |
| SMILES | C=CCOC1O[C@H](CO)[C@@H](C(=O)c2ccccc2)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O6/c1-2-8-21-16-15(20)14(19)12(11(9-17)22-16)13(18)10-6-4-3-5-7-10/h2-7,11-12,14-17,19-20H,1,8-9H2/t11-,12+,14+,15-,16?/m1/s1 |
| InChIKey | GFKVLLSSDSICCG-IDZZOLMFSA-N |
| XLogP | 0.13 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|