C18H22O8 — CID 134852831
[(3S,6S)-5-acetyloxy-4-hydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl] benzoate (PubChem CID 134852831) has the molecular formula C18H22O8 and a molecular weight of 366.37 g/mol. Its IUPAC name is [(3S,6S)-5-acetyloxy-4-hydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl] benzoate.
| Compound Name | [(3S,6S)-5-acetyloxy-4-hydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl] benzoate |
|---|---|
| PubChem CID | 134852831 |
| Molecular Formula | C18H22O8 |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | [(3S,6S)-5-acetyloxy-4-hydroxy-2-(hydroxymethyl)-6-prop-2-enoxyoxan-3-yl] benzoate |
| SMILES | C=CCO[C@H]1OC(CO)[C@@H](OC(=O)c2ccccc2)C(O)C1OC(C)=O |
| InChI | InChI=1S/C18H22O8/c1-3-9-23-18-16(24-11(2)20)14(21)15(13(10-19)25-18)26-17(22)12-7-5-4-6-8-12/h3-8,13-16,18-19,21H,1,9-10H2,2H3/t13?,14?,15-,16?,18+/m1/s1 |
| InChIKey | BITMINYLFNACKU-WIXNPGLQSA-N |
| XLogP | 0.42 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|