C8H15N3O6 — CID 90070178
(2R,3S,5S)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 90070178) has the molecular formula C8H15N3O6 and a molecular weight of 249.22 g/mol. Its IUPAC name is (2R,3S,5S)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,5S)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 90070178 |
| Molecular Formula | C8H15N3O6 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2R,3S,5S)-2-(2-azidoethoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [N-]=[N+]=NCCO[C@@H]1OC(CO)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C8H15N3O6/c9-11-10-1-2-16-8-7(15)6(14)5(13)4(3-12)17-8/h4-8,12-15H,1-3H2/t4?,5-,6?,7+,8-/m1/s1 |
| InChIKey | VGCOVRUENPCVTD-OAIINSLMSA-N |
| XLogP | -1.89 |
| TPSA | 148.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | -1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|