C14H27N3O6 — CID 172509438
(2R,4S,5S)-2-(8-azidooctoxy)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 172509438) has the molecular formula C14H27N3O6 and a molecular weight of 333.39 g/mol. Its IUPAC name is (2R,4S,5S)-2-(8-azidooctoxy)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2R,4S,5S)-2-(8-azidooctoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 172509438 |
| Molecular Formula | C14H27N3O6 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R,4S,5S)-2-(8-azidooctoxy)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | [N-]=[N+]=NCCCCCCCCO[C@@H]1OC(CO)[C@@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C14H27N3O6/c15-17-16-7-5-3-1-2-4-6-8-22-14-13(21)12(20)11(19)10(9-18)23-14/h10-14,18-21H,1-9H2/t10?,11-,12+,13?,14-/m1/s1 |
| InChIKey | WESISPXOCVYJAQ-OONHEIRLSA-N |
| XLogP | 0.45 |
| TPSA | 148.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|