C8H15N3O5 — CID 102073343
(3R,4S,5R,6R)-2-(2-azidoethoxy)-6-methyloxane-3,4,5-triol (PubChem CID 102073343) has the molecular formula C8H15N3O5 and a molecular weight of 233.22 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-(2-azidoethoxy)-6-methyloxane-3,4,5-triol.
| Compound Name | (3R,4S,5R,6R)-2-(2-azidoethoxy)-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 102073343 |
| Molecular Formula | C8H15N3O5 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | (3R,4S,5R,6R)-2-(2-azidoethoxy)-6-methyloxane-3,4,5-triol |
| SMILES | C[C@H]1OC(OCCN=[N+]=[N-])[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C8H15N3O5/c1-4-5(12)6(13)7(14)8(16-4)15-3-2-10-11-9/h4-8,12-14H,2-3H2,1H3/t4-,5+,6+,7-,8?/m1/s1 |
| InChIKey | JONLNJKPNQVZQA-XLSKCSLXSA-N |
| XLogP | -0.86 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|