C12H23N3O7 — CID 166045599
(3S,4R,5S,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-methyloxane-3,4,5-triol (PubChem CID 166045599) has the molecular formula C12H23N3O7 and a molecular weight of 321.33 g/mol. Its IUPAC name is (3S,4R,5S,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-methyloxane-3,4,5-triol.
| Compound Name | (3S,4R,5S,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-methyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 166045599 |
| Molecular Formula | C12H23N3O7 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | (3S,4R,5S,6S)-2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-6-methyloxane-3,4,5-triol |
| SMILES | C[C@@H]1OC(OCCOCCOCCN=[N+]=[N-])[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23N3O7/c1-8-9(16)10(17)11(18)12(22-8)21-7-6-20-5-4-19-3-2-14-15-13/h8-12,16-18H,2-7H2,1H3/t8-,9+,10+,11-,12?/m0/s1 |
| InChIKey | FDIUKWPBFOVGRO-LJBAMUFTSA-N |
| XLogP | -0.83 |
| TPSA | 146.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|