C13H24N4O6 — CID 118505551
N-[2-[2-(2-azidoethoxy)ethoxy]-4-hydroxy-6-(hydroxymethyl)-5-methyloxan-3-yl]acetamide (PubChem CID 118505551) has the molecular formula C13H24N4O6 and a molecular weight of 332.36 g/mol. Its IUPAC name is N-[2-[2-(2-azidoethoxy)ethoxy]-4-hydroxy-6-(hydroxymethyl)-5-methyloxan-3-yl]acetamide.
| Compound Name | N-[2-[2-(2-azidoethoxy)ethoxy]-4-hydroxy-6-(hydroxymethyl)-5-methyloxan-3-yl]acetamide |
|---|---|
| PubChem CID | 118505551 |
| Molecular Formula | C13H24N4O6 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[2-[2-(2-azidoethoxy)ethoxy]-4-hydroxy-6-(hydroxymethyl)-5-methyloxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(OCCOCCN=[N+]=[N-])OC(CO)C(C)C1O |
| InChI | InChI=1S/C13H24N4O6/c1-8-10(7-18)23-13(11(12(8)20)16-9(2)19)22-6-5-21-4-3-15-17-14/h8,10-13,18,20H,3-7H2,1-2H3,(H,16,19) |
| InChIKey | ABQKXZUSARYCAQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|