C13H23N3O9 — CID 177044424
methyl (2S,3S,4S,5R)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 177044424) has the molecular formula C13H23N3O9 and a molecular weight of 365.34 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 177044424 |
| Molecular Formula | C13H23N3O9 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | methyl (2S,3S,4S,5R)-6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(OCCOCCOCCN=[N+]=[N-])[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H23N3O9/c1-21-12(20)11-9(18)8(17)10(19)13(25-11)24-7-6-23-5-4-22-3-2-15-16-14/h8-11,13,17-19H,2-7H2,1H3/t8-,9-,10+,11-,13?/m0/s1 |
| InChIKey | RAGNITOTIIINCE-NJMOVEGISA-N |
| XLogP | -1.67 |
| TPSA | 172.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|