C10H18O9 — CID 91847358
methyl (2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxane-2-carboxylate (PubChem CID 91847358) has the molecular formula C10H18O9 and a molecular weight of 282.25 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 91847358 |
| Molecular Formula | C10H18O9 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | methyl (2S,3S,4S,5R,6S)-6-(2,3-dihydroxypropoxy)-3,4,5-trihydroxyoxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@H](OCC(O)CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H18O9/c1-17-9(16)8-6(14)5(13)7(15)10(19-8)18-3-4(12)2-11/h4-8,10-15H,2-3H2,1H3/t4?,5-,6-,7+,8-,10-/m0/s1 |
| InChIKey | BRDHNYNOHHREAW-XPZKLCHOSA-N |
| XLogP | -3.66 |
| TPSA | 145.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |