C11H16O8 — CID 89086651
methyl 3,4,5-trihydroxy-6-(2-methylprop-2-enoyloxy)oxane-2-carboxylate (PubChem CID 89086651) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is methyl 3,4,5-trihydroxy-6-(2-methylprop-2-enoyloxy)oxane-2-carboxylate.
| Compound Name | methyl 3,4,5-trihydroxy-6-(2-methylprop-2-enoyloxy)oxane-2-carboxylate |
|---|---|
| PubChem CID | 89086651 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | methyl 3,4,5-trihydroxy-6-(2-methylprop-2-enoyloxy)oxane-2-carboxylate |
| SMILES | C=C(C)C(=O)OC1OC(C(=O)OC)C(O)C(O)C1O |
| InChI | InChI=1S/C11H16O8/c1-4(2)9(15)19-11-7(14)5(12)6(13)8(18-11)10(16)17-3/h5-8,11-14H,1H2,2-3H3 |
| InChIKey | XVIFAYZBYWNPET-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|