C10H21AsO6S — CID 101356821
(2R,3R,4S,5S)-2-(2,3-dihydroxypropoxy)-5-(dimethylarsinothioylmethyl)oxolane-3,4-diol (PubChem CID 101356821) has the molecular formula C10H21AsO6S and a molecular weight of 344.26 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-(2,3-dihydroxypropoxy)-5-(dimethylarsinothioylmethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-(2,3-dihydroxypropoxy)-5-(dimethylarsinothioylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 101356821 |
| Molecular Formula | C10H21AsO6S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | (2R,3R,4S,5S)-2-(2,3-dihydroxypropoxy)-5-(dimethylarsinothioylmethyl)oxolane-3,4-diol |
| SMILES | C[As](C)(=S)C[C@H]1O[C@@H](OCC(O)CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21AsO6S/c1-11(2,18)3-7-8(14)9(15)10(17-7)16-5-6(13)4-12/h6-10,12-15H,3-5H2,1-2H3/t6?,7-,8-,9-,10-/m1/s1 |
| InChIKey | DNYYBYCTMKZRPC-BHRXDNSCSA-N |
| XLogP | -0.79 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|