C13H28AsO12P — CID 163033312
[(2R)-2,3-dihydroxypropyl] [(2S)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropyl] hydrogen phosphate (PubChem CID 163033312) has the molecular formula C13H28AsO12P and a molecular weight of 482.25 g/mol. Its IUPAC name is [(2R)-2,3-dihydroxypropyl] [(2S)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropyl] hydrogen phosphate.
| Compound Name | [(2R)-2,3-dihydroxypropyl] [(2S)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropyl] hydrogen phosphate |
|---|---|
| PubChem CID | 163033312 |
| Molecular Formula | C13H28AsO12P |
| Molecular Weight | 482.25 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | [(2R)-2,3-dihydroxypropyl] [(2S)-3-[(2R,3R,4S,5S)-5-(dimethylarsorylmethyl)-3,4-dihydroxyoxolan-2-yl]oxy-2-hydroxypropyl] hydrogen phosphate |
| SMILES | C[As](C)(=O)C[C@H]1O[C@@H](OC[C@H](O)COP(=O)(O)OC[C@H](O)CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H28AsO12P/c1-14(2,20)3-10-11(18)12(19)13(26-10)23-5-9(17)7-25-27(21,22)24-6-8(16)4-15/h8-13,15-19H,3-7H2,1-2H3,(H,21,22)/t8-,9+,10-,11-,12-,13-/m1/s1 |
| InChIKey | QZSGXTWOHIPKTE-LREJFELKSA-N |
| XLogP | -2.07 |
| TPSA | 192.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.25 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|