C10H21AsO6 — CID 101030488
(2S,3R,4S,5S)-2-(2,3-dihydroxypropyl)-5-(dimethylarsorylmethyl)oxolane-3,4-diol (PubChem CID 101030488) has the molecular formula C10H21AsO6 and a molecular weight of 312.19 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-(2,3-dihydroxypropyl)-5-(dimethylarsorylmethyl)oxolane-3,4-diol.
| Compound Name | (2S,3R,4S,5S)-2-(2,3-dihydroxypropyl)-5-(dimethylarsorylmethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 101030488 |
| Molecular Formula | C10H21AsO6 |
| Molecular Weight | 312.19 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | (2S,3R,4S,5S)-2-(2,3-dihydroxypropyl)-5-(dimethylarsorylmethyl)oxolane-3,4-diol |
| SMILES | C[As](C)(=O)C[C@H]1O[C@@H](CC(O)CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H21AsO6/c1-11(2,16)4-8-10(15)9(14)7(17-8)3-6(13)5-12/h6-10,12-15H,3-5H2,1-2H3/t6?,7-,8+,9-,10+/m0/s1 |
| InChIKey | XSJYSWMWYGZKDH-QCHRWEISSA-N |
| XLogP | -1.15 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.19 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|