C10H22AsNO9S+ — CID 101475299
CID 101475299 (PubChem CID 101475299) has the molecular formula C10H22AsNO9S+ and a molecular weight of 407.27 g/mol.
| Compound Name | CID 101475299 |
|---|---|
| PubChem CID | 101475299 |
| Molecular Formula | C10H22AsNO9S+ |
| Molecular Weight | 407.27 g/mol |
| Exact Mass | 407.02 |
| IUPAC Name | — |
| SMILES | C[As](C)(=O)C[C@H]1O[C@@H](OC[C@H](O)C[S+]([O])(=O)ON)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H22AsNO9S/c1-11(2,16)3-7-8(14)9(15)10(20-7)19-4-6(13)5-22(17,18)21-12/h6-10,13-15H,3-5,12H2,1-2H3/q+1/t6-,7+,8+,9+,10+/m0/s1 |
| InChIKey | JKJZFPVUMLYFAM-VAPHQMJDSA-N |
| XLogP | -1.90 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.27 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|