C13H25AsO7 — CID 101120490
(2R)-3-[[(3aR,4R,6S,6aS)-6-(dimethylarsorylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]propane-1,2-diol (PubChem CID 101120490) has the molecular formula C13H25AsO7 and a molecular weight of 368.26 g/mol. Its IUPAC name is (2R)-3-[[(3aR,4R,6S,6aS)-6-(dimethylarsorylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]propane-1,2-diol.
| Compound Name | (2R)-3-[[(3aR,4R,6S,6aS)-6-(dimethylarsorylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]propane-1,2-diol |
|---|---|
| PubChem CID | 101120490 |
| Molecular Formula | C13H25AsO7 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | (2R)-3-[[(3aR,4R,6S,6aS)-6-(dimethylarsorylmethyl)-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxy]propane-1,2-diol |
| SMILES | CC1(C)O[C@H]2[C@H](OC[C@H](O)CO)O[C@H](C[As](C)(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C13H25AsO7/c1-13(2)20-10-9(5-14(3,4)17)19-12(11(10)21-13)18-7-8(16)6-15/h8-12,15-16H,5-7H2,1-4H3/t8-,9-,10-,11-,12-/m1/s1 |
| InChIKey | FLGYVAQTUCTYFX-LZQZFOIKSA-N |
| XLogP | 0.24 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|