C12H21N3O9 — CID 163289943
6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid (PubChem CID 163289943) has the molecular formula C12H21N3O9 and a molecular weight of 351.31 g/mol. Its IUPAC name is 6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid.
| Compound Name | 6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 163289943 |
| Molecular Formula | C12H21N3O9 |
| Molecular Weight | 351.31 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 6-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| SMILES | [N-]=[N+]=NCCOCCOCCOC1OC(C(=O)O)C(O)C(O)C1O |
| InChI | InChI=1S/C12H21N3O9/c13-15-14-1-2-21-3-4-22-5-6-23-12-9(18)7(16)8(17)10(24-12)11(19)20/h7-10,12,16-18H,1-6H2,(H,19,20) |
| InChIKey | CAVAWVOQHDWHQG-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 183.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.31 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|