C15H27N3O6 — CID 100916232
9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxynonanoyl azide (PubChem CID 100916232) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxynonanoyl azide.
| Compound Name | 9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxynonanoyl azide |
|---|---|
| PubChem CID | 100916232 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 9-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxynonanoyl azide |
| SMILES | C[C@H]1O[C@@H](OCCCCCCCCC(=O)N=[N+]=[N-])[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H27N3O6/c1-10-12(20)13(21)14(22)15(24-10)23-9-7-5-3-2-4-6-8-11(19)17-18-16/h10,12-15,20-22H,2-9H2,1H3/t10-,12+,13+,14-,15-/m1/s1 |
| InChIKey | ODGJVFJLBMOZPR-BGNCJLHMSA-N |
| XLogP | 1.40 |
| TPSA | 144.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|