C14H15NO7S — CID 87643321
2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylisoindole-1,3-dione (PubChem CID 87643321) has the molecular formula C14H15NO7S and a molecular weight of 341.34 g/mol. Its IUPAC name is 2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylisoindole-1,3-dione.
| Compound Name | 2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylisoindole-1,3-dione |
|---|---|
| PubChem CID | 87643321 |
| Molecular Formula | C14H15NO7S |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylisoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1SC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H15NO7S/c16-5-8-9(17)10(18)11(19)14(22-8)23-15-12(20)6-3-1-2-4-7(6)13(15)21/h1-4,8-11,14,16-19H,5H2/t8-,9-,10+,11-,14?/m1/s1 |
| InChIKey | WBPIOIYDBSYIMG-BKVDRDDWSA-N |
| XLogP | -1.27 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|