C14H20O5S2 — CID 73353491
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-phenylethyldisulfanyl)oxane-3,4,5-triol (PubChem CID 73353491) has the molecular formula C14H20O5S2 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-phenylethyldisulfanyl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-phenylethyldisulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 73353491 |
| Molecular Formula | C14H20O5S2 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-(2-phenylethyldisulfanyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](SSCCc2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C14H20O5S2/c15-8-10-11(16)12(17)13(18)14(19-10)21-20-7-6-9-4-2-1-3-5-9/h1-5,10-18H,6-8H2/t10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | YALHRQFQCYFTDR-HTOAHKCRSA-N |
| XLogP | 0.41 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|