C16H25NO5S — CID 67578533
(2S,3R,4S,5R,6R)-2-[4-(3-aminophenyl)butylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 67578533) has the molecular formula C16H25NO5S and a molecular weight of 343.45 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-2-[4-(3-aminophenyl)butylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4S,5R,6R)-2-[4-(3-aminophenyl)butylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67578533 |
| Molecular Formula | C16H25NO5S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (2S,3R,4S,5R,6R)-2-[4-(3-aminophenyl)butylsulfanyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1cccc(CCCCS[C@@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)c1 |
| InChI | InChI=1S/C16H25NO5S/c17-11-6-3-5-10(8-11)4-1-2-7-23-16-15(21)14(20)13(19)12(9-18)22-16/h3,5-6,8,12-16,18-21H,1-2,4,7,9,17H2/t12-,13+,14+,15-,16+/m1/s1 |
| InChIKey | VNOWNYPQMDHSRS-CWVYHPPDSA-N |
| XLogP | 0.12 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|