C10H20O5S2 — CID 101204867
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-sulfanylbutylsulfanyl)oxane-3,4,5-triol (PubChem CID 101204867) has the molecular formula C10H20O5S2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-sulfanylbutylsulfanyl)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-sulfanylbutylsulfanyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 101204867 |
| Molecular Formula | C10H20O5S2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-(4-sulfanylbutylsulfanyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](SCCCCS)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H20O5S2/c11-5-6-7(12)8(13)9(14)10(15-6)17-4-2-1-3-16/h6-14,16H,1-5H2/t6-,7-,8+,9-,10+/m1/s1 |
| InChIKey | KLCCXNQDUKUOBK-SPFKKGSWSA-N |
| XLogP | -0.77 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|