C13H26O4S — CID 91696361
(2R,3R,4S,5R)-2-(hydroxymethyl)-5-octylsulfanyloxolane-3,4-diol (PubChem CID 91696361) has the molecular formula C13H26O4S and a molecular weight of 278.41 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(hydroxymethyl)-5-octylsulfanyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-octylsulfanyloxolane-3,4-diol |
|---|---|
| PubChem CID | 91696361 |
| Molecular Formula | C13H26O4S |
| Molecular Weight | 278.41 g/mol |
| Exact Mass | 278.16 |
| IUPAC Name | (2R,3R,4S,5R)-2-(hydroxymethyl)-5-octylsulfanyloxolane-3,4-diol |
| SMILES | CCCCCCCCS[C@H]1O[C@H](CO)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H26O4S/c1-2-3-4-5-6-7-8-18-13-12(16)11(15)10(9-14)17-13/h10-16H,2-9H2,1H3/t10-,11+,12+,13-/m1/s1 |
| InChIKey | OBXRAKZZZGBJQA-MROQNXINSA-N |
| XLogP | 1.52 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|