C12H25NO4S — CID 70264169
(2R,3R,4R,5S,6S)-5-amino-6-hexylsulfanyl-2-(hydroxymethyl)oxane-3,4-diol (PubChem CID 70264169) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is (2R,3R,4R,5S,6S)-5-amino-6-hexylsulfanyl-2-(hydroxymethyl)oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S,6S)-5-amino-6-hexylsulfanyl-2-(hydroxymethyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 70264169 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (2R,3R,4R,5S,6S)-5-amino-6-hexylsulfanyl-2-(hydroxymethyl)oxane-3,4-diol |
| SMILES | CCCCCCS[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@@H]1N |
| InChI | InChI=1S/C12H25NO4S/c1-2-3-4-5-6-18-12-9(13)11(16)10(15)8(7-14)17-12/h8-12,14-16H,2-7,13H2,1H3/t8-,9+,10+,11-,12+/m1/s1 |
| InChIKey | ICXZKIOOHJLOOI-IIRVCBMXSA-N |
| XLogP | 0.07 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|