C25H49N3O6S — CID 59928998
N-[6-[5-[(2S,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentylamino]-6-oxohexyl]octanamide (PubChem CID 59928998) has the molecular formula C25H49N3O6S and a molecular weight of 519.75 g/mol. Its IUPAC name is N-[6-[5-[(2S,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentylamino]-6-oxohexyl]octanamide.
| Compound Name | N-[6-[5-[(2S,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentylamino]-6-oxohexyl]octanamide |
|---|---|
| PubChem CID | 59928998 |
| Molecular Formula | C25H49N3O6S |
| Molecular Weight | 519.75 g/mol |
| Exact Mass | 519.33 |
| IUPAC Name | N-[6-[5-[(2S,5R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]sulfanylpentylamino]-6-oxohexyl]octanamide |
| SMILES | CCCCCCCC(=O)NCCCCCC(=O)NCCCCCS[C@@H]1OC(CO)[C@H](O)C(O)C1N |
| InChI | InChI=1S/C25H49N3O6S/c1-2-3-4-5-8-13-20(30)27-15-10-6-9-14-21(31)28-16-11-7-12-17-35-25-22(26)24(33)23(32)19(18-29)34-25/h19,22-25,29,32-33H,2-18,26H2,1H3,(H,27,30)(H,28,31)/t19?,22?,23-,24?,25-/m0/s1 |
| InChIKey | USHVVKIJQWAUCC-LANBQFEHSA-N |
| XLogP | 1.81 |
| TPSA | 154.14 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.75 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|