C14H28O4S — CID 129151889
6-heptylsulfanyl-2-(hydroxymethyl)-5-methyloxane-3,4-diol (PubChem CID 129151889) has the molecular formula C14H28O4S and a molecular weight of 292.44 g/mol. Its IUPAC name is 6-heptylsulfanyl-2-(hydroxymethyl)-5-methyloxane-3,4-diol.
| Compound Name | 6-heptylsulfanyl-2-(hydroxymethyl)-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 129151889 |
| Molecular Formula | C14H28O4S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 6-heptylsulfanyl-2-(hydroxymethyl)-5-methyloxane-3,4-diol |
| SMILES | CCCCCCCSC1OC(CO)C(O)C(O)C1C |
| InChI | InChI=1S/C14H28O4S/c1-3-4-5-6-7-8-19-14-10(2)12(16)13(17)11(9-15)18-14/h10-17H,3-9H2,1-2H3 |
| InChIKey | LCYDDLNOIYMTKK-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|