C14H27O11P3 — CID 88554856
1-[1-phosphanylcarbonyloxyethoxy-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethyl]phosphoryl]oxyethyl phosphanylformate (PubChem CID 88554856) has the molecular formula C14H27O11P3 and a molecular weight of 464.28 g/mol. Its IUPAC name is 1-[1-phosphanylcarbonyloxyethoxy-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethyl]phosphoryl]oxyethyl phosphanylformate.
| Compound Name | 1-[1-phosphanylcarbonyloxyethoxy-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethyl]phosphoryl]oxyethyl phosphanylformate |
|---|---|
| PubChem CID | 88554856 |
| Molecular Formula | C14H27O11P3 |
| Molecular Weight | 464.28 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 1-[1-phosphanylcarbonyloxyethoxy-[2-[(2R,3S,4R,5S,6R)-3,4,5-trihydroxy-6-methyloxan-2-yl]ethyl]phosphoryl]oxyethyl phosphanylformate |
| SMILES | CC(OC(=O)P)OP(=O)(CC[C@H]1O[C@H](C)[C@@H](O)[C@@H](O)[C@@H]1O)OC(C)OC(=O)P |
| InChI | InChI=1S/C14H27O11P3/c1-6-10(15)12(17)11(16)9(21-6)4-5-28(20,24-7(2)22-13(18)26)25-8(3)23-14(19)27/h6-12,15-17H,4-5,26-27H2,1-3H3/t6-,7?,8?,9-,10-,11-,12-,28?/m1/s1 |
| InChIKey | OXUKTDZJMNOCQY-LHMUCEEBSA-N |
| XLogP | 1.19 |
| TPSA | 158.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|